C7H13N3OS — CID 61252327
(2S)-2-amino-N-(cyanomethyl)-4-methylsulfanylbutanamide (PubChem CID 61252327) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyanomethyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(cyanomethyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61252327 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2S)-2-amino-N-(cyanomethyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)NCC#N |
| InChI | InChI=1S/C7H13N3OS/c1-12-5-2-6(9)7(11)10-4-3-8/h6H,2,4-5,9H2,1H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | NEMHMYIQAAWBAY-LURJTMIESA-N |
| XLogP | -0.29 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|