C8H15N3O2 — CID 81089065
2-amino-N-(cyanomethyl)-5-methoxypentanamide (PubChem CID 81089065) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-amino-N-(cyanomethyl)-5-methoxypentanamide.
| Compound Name | 2-amino-N-(cyanomethyl)-5-methoxypentanamide |
|---|---|
| PubChem CID | 81089065 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-amino-N-(cyanomethyl)-5-methoxypentanamide |
| SMILES | COCCCC(N)C(=O)NCC#N |
| InChI | InChI=1S/C8H15N3O2/c1-13-6-2-3-7(10)8(12)11-5-4-9/h7H,2-3,5-6,10H2,1H3,(H,11,12) |
| InChIKey | YLQPULIFTQEYQG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|