C9H16N4O3 — CID 87849237
[5-amino-6-(cyanomethylamino)-6-oxohexyl]carbamic acid (PubChem CID 87849237) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is [5-amino-6-(cyanomethylamino)-6-oxohexyl]carbamic acid.
| Compound Name | [5-amino-6-(cyanomethylamino)-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 87849237 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | [5-amino-6-(cyanomethylamino)-6-oxohexyl]carbamic acid |
| SMILES | N#CCNC(=O)C(N)CCCCNC(=O)O |
| InChI | InChI=1S/C9H16N4O3/c10-4-6-12-8(14)7(11)3-1-2-5-13-9(15)16/h7,13H,1-3,5-6,11H2,(H,12,14)(H,15,16) |
| InChIKey | GNQONOKLNBNQGO-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|