C22H48N6O2 — CID 4011235
2,6-diamino-N-[10-(2,6-diaminohexanoylamino)decyl]hexanamide (PubChem CID 4011235) has the molecular formula C22H48N6O2 and a molecular weight of 428.67 g/mol. Its IUPAC name is 2,6-diamino-N-[10-(2,6-diaminohexanoylamino)decyl]hexanamide.
| Compound Name | 2,6-diamino-N-[10-(2,6-diaminohexanoylamino)decyl]hexanamide |
|---|---|
| PubChem CID | 4011235 |
| Molecular Formula | C22H48N6O2 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.38 |
| IUPAC Name | 2,6-diamino-N-[10-(2,6-diaminohexanoylamino)decyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)NCCCCCCCCCCNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C22H48N6O2/c23-15-9-7-13-19(25)21(29)27-17-11-5-3-1-2-4-6-12-18-28-22(30)20(26)14-8-10-16-24/h19-20H,1-18,23-26H2,(H,27,29)(H,28,30) |
| InChIKey | XXVHKYDTGOLUEB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|