C19H39N5O4 — CID 58195957
(2S)-2-amino-6-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]hexanoic acid (PubChem CID 58195957) has the molecular formula C19H39N5O4 and a molecular weight of 401.55 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58195957 |
| Molecular Formula | C19H39N5O4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | (2S)-2-amino-6-[[(2S,9S)-2,9,13-triamino-8-oxotridecanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)CCCCC[C@H](N)C(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C19H39N5O4/c20-12-6-4-8-14(21)17(25)11-3-1-2-9-15(22)18(26)24-13-7-5-10-16(23)19(27)28/h14-16H,1-13,20-23H2,(H,24,26)(H,27,28)/t14-,15-,16-/m0/s1 |
| InChIKey | WYTYEJWHCJVEHB-JYJNAYRXSA-N |
| XLogP | -0.01 |
| TPSA | 187.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|