C13H28N4O2 — CID 89285466
(2S)-2,6-diamino-N-[(5S)-5-amino-6-oxoheptyl]hexanamide (PubChem CID 89285466) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(5S)-5-amino-6-oxoheptyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(5S)-5-amino-6-oxoheptyl]hexanamide |
|---|---|
| PubChem CID | 89285466 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (2S)-2,6-diamino-N-[(5S)-5-amino-6-oxoheptyl]hexanamide |
| SMILES | CC(=O)[C@@H](N)CCCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C13H28N4O2/c1-10(18)11(15)6-3-5-9-17-13(19)12(16)7-2-4-8-14/h11-12H,2-9,14-16H2,1H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | GCNVQOBGMHSXHO-RYUDHWBXSA-N |
| XLogP | -0.35 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|