C30H56N10O4 — CID 58984407
2,6-diamino-N-[5-amino-6-[4-[[2-amino-6-(2,6-diaminohexanoylamino)hexanoyl]amino]anilino]-6-oxohexyl]hexanamide (PubChem CID 58984407) has the molecular formula C30H56N10O4 and a molecular weight of 620.84 g/mol. Its IUPAC name is 2,6-diamino-N-[5-amino-6-[4-[[2-amino-6-(2,6-diaminohexanoylamino)hexanoyl]amino]anilino]-6-oxohexyl]hexanamide.
| Compound Name | 2,6-diamino-N-[5-amino-6-[4-[[2-amino-6-(2,6-diaminohexanoylamino)hexanoyl]amino]anilino]-6-oxohexyl]hexanamide |
|---|---|
| PubChem CID | 58984407 |
| Molecular Formula | C30H56N10O4 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.45 |
| IUPAC Name | 2,6-diamino-N-[5-amino-6-[4-[[2-amino-6-(2,6-diaminohexanoylamino)hexanoyl]amino]anilino]-6-oxohexyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)NCCCCC(N)C(=O)Nc1ccc(NC(=O)C(N)CCCCNC(=O)C(N)CCCCN)cc1 |
| InChI | InChI=1S/C30H56N10O4/c31-17-5-1-9-23(33)27(41)37-19-7-3-11-25(35)29(43)39-21-13-15-22(16-14-21)40-30(44)26(36)12-4-8-20-38-28(42)24(34)10-2-6-18-32/h13-16,23-26H,1-12,17-20,31-36H2,(H,37,41)(H,38,42)(H,39,43)(H,40,44) |
| InChIKey | LDZLCTADKFWPIT-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 272.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|