C32H44N8O6 — CID 25107498
(2S)-2,6-diamino-N-[3-[[6-[3-[[(2S)-2,6-diaminohexanoyl]amino]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]hexanamide (PubChem CID 25107498) has the molecular formula C32H44N8O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[3-[[6-[3-[[(2S)-2,6-diaminohexanoyl]amino]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[3-[[6-[3-[[(2S)-2,6-diaminohexanoyl]amino]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]hexanamide |
|---|---|
| PubChem CID | 25107498 |
| Molecular Formula | C32H44N8O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | (2S)-2,6-diamino-N-[3-[[6-[3-[[(2S)-2,6-diaminohexanoyl]amino]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCC(=O)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CCNC(=O)[C@@H](N)CCCCN)cc1C2=O |
| InChI | InChI=1S/C32H44N8O6/c33-13-3-1-5-25(35)31(45)37-15-11-27(41)39-19-7-9-21-23(17-19)29(43)22-10-8-20(18-24(22)30(21)44)40-28(42)12-16-38-32(46)26(36)6-2-4-14-34/h7-10,17-18,25-26H,1-6,11-16,33-36H2,(H,37,45)(H,38,46)(H,39,41)(H,40,42)/t25-,26-/m0/s1 |
| InChIKey | LLWCZKJYRRFFEA-UIOOFZCWSA-N |
| XLogP | 0.26 |
| TPSA | 254.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|