C26H32N8O6 — CID 127031661
2,4-diamino-N-[2-[[6-[[2-(2,4-diaminobutanoylamino)acetyl]amino]-9,10-dioxoanthracen-2-yl]amino]-2-oxoethyl]butanamide (PubChem CID 127031661) has the molecular formula C26H32N8O6 and a molecular weight of 552.59 g/mol. Its IUPAC name is 2,4-diamino-N-[2-[[6-[[2-(2,4-diaminobutanoylamino)acetyl]amino]-9,10-dioxoanthracen-2-yl]amino]-2-oxoethyl]butanamide.
| Compound Name | 2,4-diamino-N-[2-[[6-[[2-(2,4-diaminobutanoylamino)acetyl]amino]-9,10-dioxoanthracen-2-yl]amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 127031661 |
| Molecular Formula | C26H32N8O6 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2,4-diamino-N-[2-[[6-[[2-(2,4-diaminobutanoylamino)acetyl]amino]-9,10-dioxoanthracen-2-yl]amino]-2-oxoethyl]butanamide |
| SMILES | NCCC(N)C(=O)NCC(=O)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CNC(=O)C(N)CCN)cc1C2=O |
| InChI | InChI=1S/C26H32N8O6/c27-7-5-19(29)25(39)31-11-21(35)33-13-1-3-15-17(9-13)24(38)16-4-2-14(10-18(16)23(15)37)34-22(36)12-32-26(40)20(30)6-8-28/h1-4,9-10,19-20H,5-8,11-12,27-30H2,(H,31,39)(H,32,40)(H,33,35)(H,34,36) |
| InChIKey | JNIXHIGITWMSMP-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 254.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|