C18H16N2O3S — CID 84553428
2-(2-aminoethylsulfanyl)-N-(9,10-dioxoanthracen-2-yl)acetamide (PubChem CID 84553428) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(9,10-dioxoanthracen-2-yl)acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(9,10-dioxoanthracen-2-yl)acetamide |
|---|---|
| PubChem CID | 84553428 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(9,10-dioxoanthracen-2-yl)acetamide |
| SMILES | NCCSCC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16N2O3S/c19-7-8-24-10-16(21)20-11-5-6-14-15(9-11)18(23)13-4-2-1-3-12(13)17(14)22/h1-6,9H,7-8,10,19H2,(H,20,21) |
| InChIKey | LKGDKIZNXWYTRL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|