C19H13N3O3S3 — CID 6492795
N-(9,10-dioxoanthracen-2-yl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 6492795) has the molecular formula C19H13N3O3S3 and a molecular weight of 427.53 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6492795 |
| Molecular Formula | C19H13N3O3S3 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | CSc1nsc(SCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C19H13N3O3S3/c1-26-18-21-19(28-22-18)27-9-15(23)20-10-6-7-13-14(8-10)17(25)12-5-3-2-4-11(12)16(13)24/h2-8H,9H2,1H3,(H,20,23) |
| InChIKey | AYEMSSYQHJIBMA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|