C25H17N3O4S — CID 4264727
N-(9,10-dioxoanthracen-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 4264727) has the molecular formula C25H17N3O4S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4264727 |
| Molecular Formula | C25H17N3O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H17N3O4S/c1-28-24(32)18-8-4-5-9-20(18)27-25(28)33-13-21(29)26-14-10-11-17-19(12-14)23(31)16-7-3-2-6-15(16)22(17)30/h2-12H,13H2,1H3,(H,26,29) |
| InChIKey | QDMDCNXGBOVVDC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|