C27H19N3O4S — CID 5202259
N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 5202259) has the molecular formula C27H19N3O4S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 5202259 |
| Molecular Formula | C27H19N3O4S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H19N3O4S/c1-2-13-30-26(34)20-9-5-6-10-22(20)29-27(30)35-15-23(31)28-16-11-12-19-21(14-16)25(33)18-8-4-3-7-17(18)24(19)32/h2-12,14H,1,13,15H2,(H,28,31) |
| InChIKey | CVHBDSASKQDFGF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|