C22H20N4O5S — CID 2632918
N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 2632918) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2632918 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)NC(=O)Nc2ccc3c(c2)OCCO3)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H20N4O5S/c1-2-9-26-20(28)15-5-3-4-6-16(15)24-22(26)32-13-19(27)25-21(29)23-14-7-8-17-18(12-14)31-11-10-30-17/h2-8,12H,1,9-11,13H2,(H2,23,25,27,29) |
| InChIKey | XSXADUIJSXSWNJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|