C19H16IN3O2S — CID 4809677
N-(4-iodophenyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 4809677) has the molecular formula C19H16IN3O2S and a molecular weight of 477.33 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-iodophenyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4809677 |
| Molecular Formula | C19H16IN3O2S |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | N-(4-iodophenyl)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(I)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H16IN3O2S/c1-2-11-23-18(25)15-5-3-4-6-16(15)22-19(23)26-12-17(24)21-14-9-7-13(20)8-10-14/h2-10H,1,11-12H2,(H,21,24) |
| InChIKey | VUPTYCMJOVYDPR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|