C13H11N2O3S- — CID 6943444
2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate (PubChem CID 6943444) has the molecular formula C13H11N2O3S- and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate.
| Compound Name | 2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 6943444 |
| Molecular Formula | C13H11N2O3S- |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate |
| SMILES | C=CCn1c(SCC(=O)[O-])nc2ccccc2c1=O |
| InChI | InChI=1S/C13H12N2O3S/c1-2-7-15-12(18)9-5-3-4-6-10(9)14-13(15)19-8-11(16)17/h2-6H,1,7-8H2,(H,16,17)/p-1 |
| InChIKey | TXJYLJLBDUXVPK-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|