C15H12N3O3S- — CID 7501750
2-[(4-oxo-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetate (PubChem CID 7501750) has the molecular formula C15H12N3O3S- and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-[(4-oxo-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetate.
| Compound Name | 2-[(4-oxo-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 7501750 |
| Molecular Formula | C15H12N3O3S- |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[(4-oxo-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetate |
| SMILES | C=CCn1c(SCC(=O)[O-])nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C15H13N3O3S/c1-2-7-18-14(21)13-12(17-15(18)22-8-11(19)20)9-5-3-4-6-10(9)16-13/h2-6,16H,1,7-8H2,(H,19,20)/p-1 |
| InChIKey | GVLCEDGZZSJVDY-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|