C20H24N4OS — CID 7501734
2-(2-piperidin-1-ylethylsulfanyl)-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 7501734) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethylsulfanyl)-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 2-(2-piperidin-1-ylethylsulfanyl)-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 7501734 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-(2-piperidin-1-ylethylsulfanyl)-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | C=CCn1c(SCCN2CCCCC2)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C20H24N4OS/c1-2-10-24-19(25)18-17(15-8-4-5-9-16(15)21-18)22-20(24)26-14-13-23-11-6-3-7-12-23/h2,4-5,8-9,21H,1,3,6-7,10-14H2 |
| InChIKey | JPQDLSZHLLTNMM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|