C14H14N4O2S — CID 7501486
2-[(3-ethyl-4-oxo-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetamide (PubChem CID 7501486) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-[(3-ethyl-4-oxo-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetamide.
| Compound Name | 2-[(3-ethyl-4-oxo-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7501486 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(3-ethyl-4-oxo-5H-pyrimido[5,4-b]indol-2-yl)sulfanyl]acetamide |
| SMILES | CCn1c(SCC(N)=O)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C14H14N4O2S/c1-2-18-13(20)12-11(17-14(18)21-7-10(15)19)8-5-3-4-6-9(8)16-12/h3-6,16H,2,7H2,1H3,(H2,15,19) |
| InChIKey | KDVNLVDEVLWDQL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |