C20H17N3O2S — CID 7501565
3-ethyl-2-phenacylsulfanyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 7501565) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-ethyl-2-phenacylsulfanyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-ethyl-2-phenacylsulfanyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 7501565 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-ethyl-2-phenacylsulfanyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | CCn1c(SCC(=O)c2ccccc2)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C20H17N3O2S/c1-2-23-19(25)18-17(14-10-6-7-11-15(14)21-18)22-20(23)26-12-16(24)13-8-4-3-5-9-13/h3-11,21H,2,12H2,1H3 |
| InChIKey | SIYRBFQWXASAQV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |