C19H24N4OS — CID 7501730
2-[2-(diethylamino)ethylsulfanyl]-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 7501730) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 7501730 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-3-prop-2-enyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | C=CCn1c(SCCN(CC)CC)nc2c([nH]c3ccccc32)c1=O |
| InChI | InChI=1S/C19H24N4OS/c1-4-11-23-18(24)17-16(14-9-7-8-10-15(14)20-17)21-19(23)25-13-12-22(5-2)6-3/h4,7-10,20H,1,5-6,11-13H2,2-3H3 |
| InChIKey | GEOIAJJEOCJXHF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|