C21H20N2O2S — CID 112780592
2-(4-oxo-4-phenylbutyl)sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 112780592) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(4-oxo-4-phenylbutyl)sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-(4-oxo-4-phenylbutyl)sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 112780592 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(4-oxo-4-phenylbutyl)sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCCCC(=O)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H20N2O2S/c1-2-14-23-20(25)17-11-6-7-12-18(17)22-21(23)26-15-8-13-19(24)16-9-4-3-5-10-16/h2-7,9-12H,1,8,13-15H2 |
| InChIKey | FYHPIPGLADQBTG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|