C20H21N3O2S — CID 2084323
2-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 2084323) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 2084323 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(C)c2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H21N3O2S/c1-5-10-23-19(25)15-8-6-7-9-17(15)21-20(23)26-12-18(24)16-11-13(2)22(4)14(16)3/h5-9,11H,1,10,12H2,2-4H3 |
| InChIKey | KQXZRBCWJCLABH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|