C20H22N4OS — CID 5136879
2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 5136879) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 5136879 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)n(C)c2C)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS/c1-5-11-24-19(16-9-7-6-8-10-16)21-22-20(24)26-13-18(25)17-12-14(2)23(4)15(17)3/h5-10,12H,1,11,13H2,2-4H3 |
| InChIKey | KPUUEYWMPOFEKK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|