C23H23FN2O3S — CID 25490734
2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 25490734) has the molecular formula C23H23FN2O3S and a molecular weight of 426.51 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 25490734 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=C(CCCSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O3S/c24-17-11-9-16(10-12-17)21(27)8-4-14-30-23-25-20-7-2-1-6-19(20)22(28)26(23)15-18-5-3-13-29-18/h1-2,6-7,9-12,18H,3-5,8,13-15H2/t18-/m0/s1 |
| InChIKey | BBFRZISINSSQLJ-SFHVURJKSA-N |
| XLogP | 4.47 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|