C21H21FN2O2S2 — CID 7869158
2-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 7869158) has the molecular formula C21H21FN2O2S2 and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7869158 |
| Molecular Formula | C21H21FN2O2S2 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCCSc2ccccc2F)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H21FN2O2S2/c22-17-8-2-4-10-19(17)27-12-13-28-21-23-18-9-3-1-7-16(18)20(25)24(21)14-15-6-5-11-26-15/h1-4,7-10,15H,5-6,11-14H2/t15-/m1/s1 |
| InChIKey | NNUHWXDSNQVAOE-OAHLLOKOSA-N |
| XLogP | 4.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|