C22H24N2O4S — CID 7868999
2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 7868999) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7868999 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | COc1ccc(OCCSc2nc3ccccc3c(=O)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-26-16-8-10-17(11-9-16)28-13-14-29-22-23-20-7-3-2-6-19(20)21(25)24(22)15-18-5-4-12-27-18/h2-3,6-11,18H,4-5,12-15H2,1H3/t18-/m0/s1 |
| InChIKey | ONDCWUFDWDBXBK-SFHVURJKSA-N |
| XLogP | 3.76 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|