C21H21N3O5S — CID 51954857
2-[2-(3-nitrophenoxy)ethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 51954857) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[2-(3-nitrophenoxy)ethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[2-(3-nitrophenoxy)ethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 51954857 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[2-(3-nitrophenoxy)ethylsulfanyl]-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCCOc2cccc([N+](=O)[O-])c2)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H21N3O5S/c25-20-18-8-1-2-9-19(18)22-21(23(20)14-17-7-4-10-28-17)30-12-11-29-16-6-3-5-15(13-16)24(26)27/h1-3,5-6,8-9,13,17H,4,7,10-12,14H2/t17-/m1/s1 |
| InChIKey | RKTWYHJDEITGAI-QGZVFWFLSA-N |
| XLogP | 3.65 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|