C20H19N3O4S — CID 41176704
2-[(3-nitrophenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 41176704) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[(3-nitrophenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 41176704 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[(3-nitrophenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2cccc([N+](=O)[O-])c2)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H19N3O4S/c24-19-17-8-1-2-9-18(17)21-20(22(19)12-16-7-4-10-27-16)28-13-14-5-3-6-15(11-14)23(25)26/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2/t16-/m0/s1 |
| InChIKey | KNZMPPOUCCAZIY-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|