C21H20N2O3S — CID 4249826
3-(oxolan-2-ylmethyl)-2-phenacylsulfanylquinazolin-4-one (PubChem CID 4249826) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-2-phenacylsulfanylquinazolin-4-one.
| Compound Name | 3-(oxolan-2-ylmethyl)-2-phenacylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 4249826 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-2-phenacylsulfanylquinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3S/c24-19(15-7-2-1-3-8-15)14-27-21-22-18-11-5-4-10-17(18)20(25)23(21)13-16-9-6-12-26-16/h1-5,7-8,10-11,16H,6,9,12-14H2 |
| InChIKey | NMMRACNUNXZEAQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |