C16H18N4O4S — CID 2651496
N-carbamoyl-2-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylacetamide (PubChem CID 2651496) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-carbamoyl-2-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-carbamoyl-2-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2651496 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-carbamoyl-2-[4-oxo-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylacetamide |
| SMILES | NC(=O)NC(=O)CSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H18N4O4S/c17-15(23)19-13(21)9-25-16-18-12-6-2-1-5-11(12)14(22)20(16)8-10-4-3-7-24-10/h1-2,5-6,10H,3-4,7-9H2,(H3,17,19,21,23)/t10-/m0/s1 |
| InChIKey | UVVVGVVVQMCQNT-JTQLQIEISA-N |
| XLogP | 0.86 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |