C21H19FN2O3S — CID 7515515
2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 7515515) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7515515 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[2-(2-fluorophenyl)-2-oxoethyl]sulfanyl-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C[C@@H]1CCCO1)c1ccccc1F |
| InChI | InChI=1S/C21H19FN2O3S/c22-17-9-3-1-7-15(17)19(25)13-28-21-23-18-10-4-2-8-16(18)20(26)24(21)12-14-6-5-11-27-14/h1-4,7-10,14H,5-6,11-13H2/t14-/m0/s1 |
| InChIKey | REVCOQTXDAJRTN-AWEZNQCLSA-N |
| XLogP | 3.69 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |