C21H20ClFN2O3S — CID 41296647
7-chloro-2-[2-(4-fluorophenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 41296647) has the molecular formula C21H20ClFN2O3S and a molecular weight of 434.92 g/mol. Its IUPAC name is 7-chloro-2-[2-(4-fluorophenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 7-chloro-2-[2-(4-fluorophenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 41296647 |
| Molecular Formula | C21H20ClFN2O3S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 7-chloro-2-[2-(4-fluorophenoxy)ethylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(SCCOc2ccc(F)cc2)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H20ClFN2O3S/c22-14-3-8-18-19(12-14)24-21(25(20(18)26)13-17-2-1-9-27-17)29-11-10-28-16-6-4-15(23)5-7-16/h3-8,12,17H,1-2,9-11,13H2/t17-/m0/s1 |
| InChIKey | QAEATRBMWHOZNL-KRWDZBQOSA-N |
| XLogP | 4.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|