C21H21ClN2O2S — CID 7739354
7-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one (PubChem CID 7739354) has the molecular formula C21H21ClN2O2S and a molecular weight of 400.93 g/mol. Its IUPAC name is 7-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one.
| Compound Name | 7-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7739354 |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 7-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-[[(2S)-oxolan-2-yl]methyl]quinazolin-4-one |
| SMILES | Cc1ccc(CSc2nc3cc(Cl)ccc3c(=O)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H21ClN2O2S/c1-14-4-6-15(7-5-14)13-27-21-23-19-11-16(22)8-9-18(19)20(25)24(21)12-17-3-2-10-26-17/h4-9,11,17H,2-3,10,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | SKIPVCGHPKSSEU-KRWDZBQOSA-N |
| XLogP | 4.83 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |