C16H19ClN2O2S — CID 41095575
7-chloro-3-[[(2S)-oxolan-2-yl]methyl]-2-propan-2-ylsulfanylquinazolin-4-one (PubChem CID 41095575) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 7-chloro-3-[[(2S)-oxolan-2-yl]methyl]-2-propan-2-ylsulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-[[(2S)-oxolan-2-yl]methyl]-2-propan-2-ylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 41095575 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 7-chloro-3-[[(2S)-oxolan-2-yl]methyl]-2-propan-2-ylsulfanylquinazolin-4-one |
| SMILES | CC(C)Sc1nc2cc(Cl)ccc2c(=O)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-10(2)22-16-18-14-8-11(17)5-6-13(14)15(20)19(16)9-12-4-3-7-21-12/h5-6,8,10,12H,3-4,7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | PBVZKFKMKWZRHO-LBPRGKRZSA-N |
| XLogP | 3.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |