C19H18ClN3O2S — CID 17469811
7-chloro-3-(oxolan-2-ylmethyl)-2-(pyridin-2-ylmethylsulfanyl)quinazolin-4-one (PubChem CID 17469811) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is 7-chloro-3-(oxolan-2-ylmethyl)-2-(pyridin-2-ylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 7-chloro-3-(oxolan-2-ylmethyl)-2-(pyridin-2-ylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 17469811 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 7-chloro-3-(oxolan-2-ylmethyl)-2-(pyridin-2-ylmethylsulfanyl)quinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(SCc2ccccn2)n1CC1CCCO1 |
| InChI | InChI=1S/C19H18ClN3O2S/c20-13-6-7-16-17(10-13)22-19(26-12-14-4-1-2-8-21-14)23(18(16)24)11-15-5-3-9-25-15/h1-2,4,6-8,10,15H,3,5,9,11-12H2 |
| InChIKey | DWMLAMDBVOTVDX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |