C20H25N3O2S — CID 2680340
2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 2680340) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 2680340 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCC(=O)N2[C@H](C)CCC[C@@H]2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H25N3O2S/c1-4-12-22-19(25)16-10-5-6-11-17(16)21-20(22)26-13-18(24)23-14(2)8-7-9-15(23)3/h4-6,10-11,14-15H,1,7-9,12-13H2,2-3H3/t14-,15+ |
| InChIKey | QOCLBZXDZQTQIV-GASCZTMLSA-N |
| XLogP | 3.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|