C16H18N2O2S — CID 78761732
2-(oxolan-2-ylmethylsulfanyl)-3-prop-2-enylquinazolin-4-one (PubChem CID 78761732) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 78761732 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCC2CCCO2)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H18N2O2S/c1-2-9-18-15(19)13-7-3-4-8-14(13)17-16(18)21-11-12-6-5-10-20-12/h2-4,7-8,12H,1,5-6,9-11H2 |
| InChIKey | FWPXFQHRZOUZGW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|