C22H24N2O2S — CID 16533643
2-(oxolan-2-ylmethylsulfanyl)-3-(2-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 16533643) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-3-(2-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-3-(2-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 16533643 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-3-(2-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CC(C)c1ccccc1-n1c(SCC2CCCO2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H24N2O2S/c1-15(2)17-9-4-6-12-20(17)24-21(25)18-10-3-5-11-19(18)23-22(24)27-14-16-8-7-13-26-16/h3-6,9-12,15-16H,7-8,13-14H2,1-2H3 |
| InChIKey | GKWNHHUBKYJWOU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |