C22H24N2O2S — CID 4812088
3-(3,5-dimethylphenyl)-2-(oxan-2-ylmethylsulfanyl)quinazolin-4-one (PubChem CID 4812088) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-2-(oxan-2-ylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(3,5-dimethylphenyl)-2-(oxan-2-ylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4812088 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-2-(oxan-2-ylmethylsulfanyl)quinazolin-4-one |
| SMILES | Cc1cc(C)cc(-n2c(SCC3CCCCO3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H24N2O2S/c1-15-11-16(2)13-17(12-15)24-21(25)19-8-3-4-9-20(19)23-22(24)27-14-18-7-5-6-10-26-18/h3-4,8-9,11-13,18H,5-7,10,14H2,1-2H3 |
| InChIKey | YGYFKTXDOKHRDX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |