C21H22N2O3S — CID 9360924
3-(2-methoxyphenyl)-2-[[(2R)-oxan-2-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 9360924) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[[(2R)-oxan-2-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[[(2R)-oxan-2-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 9360924 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[[(2R)-oxan-2-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccccc1-n1c(SC[C@H]2CCCCO2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H22N2O3S/c1-25-19-12-5-4-11-18(19)23-20(24)16-9-2-3-10-17(16)22-21(23)27-14-15-8-6-7-13-26-15/h2-5,9-12,15H,6-8,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | AILVSQDMRXZJJU-OAHLLOKOSA-N |
| XLogP | 4.06 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |