C19H16Cl2N2O2S — CID 8601292
7-chloro-3-(3-chlorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 8601292) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is 7-chloro-3-(3-chlorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-chlorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8601292 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 7-chloro-3-(3-chlorophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(SC[C@H]2CCCO2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c20-12-3-1-4-14(9-12)23-18(24)16-7-6-13(21)10-17(16)22-19(23)26-11-15-5-2-8-25-15/h1,3-4,6-7,9-10,15H,2,5,8,11H2/t15-/m1/s1 |
| InChIKey | JHZSCKMVSYLVEP-OAHLLOKOSA-N |
| XLogP | 4.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |