C18H17ClN2O3S — CID 17392958
7-chloro-3-(furan-2-ylmethyl)-2-(oxolan-2-ylmethylsulfanyl)quinazolin-4-one (PubChem CID 17392958) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 7-chloro-3-(furan-2-ylmethyl)-2-(oxolan-2-ylmethylsulfanyl)quinazolin-4-one.
| Compound Name | 7-chloro-3-(furan-2-ylmethyl)-2-(oxolan-2-ylmethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 17392958 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 7-chloro-3-(furan-2-ylmethyl)-2-(oxolan-2-ylmethylsulfanyl)quinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(SCC2CCCO2)n1Cc1ccco1 |
| InChI | InChI=1S/C18H17ClN2O3S/c19-12-5-6-15-16(9-12)20-18(25-11-14-4-2-8-24-14)21(17(15)22)10-13-3-1-7-23-13/h1,3,5-7,9,14H,2,4,8,10-11H2 |
| InChIKey | KLAGFCVUFIBXBH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |