C17H13ClN2O4S — CID 2567846
7-chloro-3-(furan-2-ylmethyl)-2-[(3R)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one (PubChem CID 2567846) has the molecular formula C17H13ClN2O4S and a molecular weight of 376.82 g/mol. Its IUPAC name is 7-chloro-3-(furan-2-ylmethyl)-2-[(3R)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(3R)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2567846 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(3R)-2-oxooxolan-3-yl]sulfanylquinazolin-4-one |
| SMILES | O=C1OCC[C@H]1Sc1nc2cc(Cl)ccc2c(=O)n1Cc1ccco1 |
| InChI | InChI=1S/C17H13ClN2O4S/c18-10-3-4-12-13(8-10)19-17(25-14-5-7-24-16(14)22)20(15(12)21)9-11-2-1-6-23-11/h1-4,6,8,14H,5,7,9H2/t14-/m1/s1 |
| InChIKey | UKXXTOUTIXPVIY-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |