C18H15ClN2O3S — CID 2680002
7-chloro-3-(furan-2-ylmethyl)-2-[(1S)-2-oxocyclopentyl]sulfanylquinazolin-4-one (PubChem CID 2680002) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 7-chloro-3-(furan-2-ylmethyl)-2-[(1S)-2-oxocyclopentyl]sulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(1S)-2-oxocyclopentyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2680002 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(1S)-2-oxocyclopentyl]sulfanylquinazolin-4-one |
| SMILES | O=C1CCC[C@@H]1Sc1nc2cc(Cl)ccc2c(=O)n1Cc1ccco1 |
| InChI | InChI=1S/C18H15ClN2O3S/c19-11-6-7-13-14(9-11)20-18(25-16-5-1-4-15(16)22)21(17(13)23)10-12-3-2-8-24-12/h2-3,6-9,16H,1,4-5,10H2/t16-/m0/s1 |
| InChIKey | QKFNYCDTUNLXCT-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |