C20H14ClN3O4S — CID 4818921
7-chloro-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 4818921) has the molecular formula C20H14ClN3O4S and a molecular weight of 427.87 g/mol. Its IUPAC name is 7-chloro-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4818921 |
| Molecular Formula | C20H14ClN3O4S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 7-chloro-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccc(Cl)cc2nc(SCc2ccc([N+](=O)[O-])cc2)n1Cc1ccco1 |
| InChI | InChI=1S/C20H14ClN3O4S/c21-14-5-8-17-18(10-14)22-20(23(19(17)25)11-16-2-1-9-28-16)29-12-13-3-6-15(7-4-13)24(26)27/h1-10H,11-12H2 |
| InChIKey | AMNZSYIZICINEE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|