C21H17N3O3S — CID 26962068
4-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide (PubChem CID 26962068) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | 4-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 26962068 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccccc3c(=O)n2Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H17N3O3S/c22-19(25)15-9-7-14(8-10-15)13-28-21-23-18-6-2-1-5-17(18)20(26)24(21)12-16-4-3-11-27-16/h1-11H,12-13H2,(H2,22,25) |
| InChIKey | MKZVAIRCTVNHPQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |