C23H18ClN3O2S — CID 24526797
4-[[3-[(2-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide (PubChem CID 24526797) has the molecular formula C23H18ClN3O2S and a molecular weight of 435.94 g/mol. Its IUPAC name is 4-[[3-[(2-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | 4-[[3-[(2-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 24526797 |
| Molecular Formula | C23H18ClN3O2S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-[[3-[(2-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccccc3c(=O)n2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O2S/c24-19-7-3-1-5-17(19)13-27-22(29)18-6-2-4-8-20(18)26-23(27)30-14-15-9-11-16(12-10-15)21(25)28/h1-12H,13-14H2,(H2,25,28) |
| InChIKey | ATRBWPCFQQYFFD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |