C22H16ClN3O2S — CID 26970971
4-[[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide (PubChem CID 26970971) has the molecular formula C22H16ClN3O2S and a molecular weight of 421.91 g/mol. Its IUPAC name is 4-[[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | 4-[[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 26970971 |
| Molecular Formula | C22H16ClN3O2S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-[[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccccc3c(=O)n2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H16ClN3O2S/c23-16-4-3-5-17(12-16)26-21(28)18-6-1-2-7-19(18)25-22(26)29-13-14-8-10-15(11-9-14)20(24)27/h1-12H,13H2,(H2,24,27) |
| InChIKey | KNVPBORYIKMHBF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |