C21H21N3O2S — CID 27350175
4-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]benzamide (PubChem CID 27350175) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]benzamide.
| Compound Name | 4-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 27350175 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CSc2nc3ccccc3c(=O)n2C2CCCC2)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c22-19(25)15-11-9-14(10-12-15)13-27-21-23-18-8-4-3-7-17(18)20(26)24(21)16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13H2,(H2,22,25) |
| InChIKey | LMOCEEKPIFVDPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |